C35H42N2O3 — CID 139689106
3-[2-butoxy-4-(diethylamino)phenyl]-3-(1-butyl-2-methylindol-3-yl)-2-benzofuran-1-one (PubChem CID 139689106) has the molecular formula C35H42N2O3 and a molecular weight of 538.73 g/mol. Its IUPAC name is 3-[2-butoxy-4-(diethylamino)phenyl]-3-(1-butyl-2-methylindol-3-yl)-2-benzofuran-1-one.
| Compound Name | 3-[2-butoxy-4-(diethylamino)phenyl]-3-(1-butyl-2-methylindol-3-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139689106 |
| Molecular Formula | C35H42N2O3 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | 3-[2-butoxy-4-(diethylamino)phenyl]-3-(1-butyl-2-methylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CCCCOc1cc(N(CC)CC)ccc1C1(c2c(C)n(CCCC)c3ccccc23)OC(=O)c2ccccc21 |
| InChI | InChI=1S/C35H42N2O3/c1-6-10-22-37-25(5)33(28-17-13-15-19-31(28)37)35(29-18-14-12-16-27(29)34(38)40-35)30-21-20-26(36(8-3)9-4)24-32(30)39-23-11-7-2/h12-21,24H,6-11,22-23H2,1-5H3 |
| InChIKey | UATHJRKGBMQDDY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|