C41H51N3O2 — CID 139669542
5,5-bis(2-methyl-1-octylindol-3-yl)furo[3,4-b]pyridin-7-one (PubChem CID 139669542) has the molecular formula C41H51N3O2 and a molecular weight of 617.88 g/mol. Its IUPAC name is 5,5-bis(2-methyl-1-octylindol-3-yl)furo[3,4-b]pyridin-7-one.
| Compound Name | 5,5-bis(2-methyl-1-octylindol-3-yl)furo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 139669542 |
| Molecular Formula | C41H51N3O2 |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | 5,5-bis(2-methyl-1-octylindol-3-yl)furo[3,4-b]pyridin-7-one |
| SMILES | CCCCCCCCn1c(C)c(C2(c3c(C)n(CCCCCCCC)c4ccccc34)OC(=O)c3ncccc32)c2ccccc21 |
| InChI | InChI=1S/C41H51N3O2/c1-5-7-9-11-13-19-28-43-30(3)37(32-22-15-17-25-35(32)43)41(34-24-21-27-42-39(34)40(45)46-41)38-31(4)44(29-20-14-12-10-8-6-2)36-26-18-16-23-33(36)38/h15-18,21-27H,5-14,19-20,28-29H2,1-4H3 |
| InChIKey | FWQXRMVKBHYFGW-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|