C33H35N3O2 — CID 139885872
7-(1-ethyl-2-methylindol-3-yl)-7-(1-hexyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one (PubChem CID 139885872) has the molecular formula C33H35N3O2 and a molecular weight of 505.66 g/mol. Its IUPAC name is 7-(1-ethyl-2-methylindol-3-yl)-7-(1-hexyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one.
| Compound Name | 7-(1-ethyl-2-methylindol-3-yl)-7-(1-hexyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139885872 |
| Molecular Formula | C33H35N3O2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 7-(1-ethyl-2-methylindol-3-yl)-7-(1-hexyl-2-methylindol-3-yl)furo[3,4-b]pyridin-5-one |
| SMILES | CCCCCCn1c(C)c(C2(c3c(C)n(CC)c4ccccc34)OC(=O)c3cccnc32)c2ccccc21 |
| InChI | InChI=1S/C33H35N3O2/c1-5-7-8-13-21-36-23(4)30(25-16-10-12-19-28(25)36)33(31-26(32(37)38-33)17-14-20-34-31)29-22(3)35(6-2)27-18-11-9-15-24(27)29/h9-12,14-20H,5-8,13,21H2,1-4H3 |
| InChIKey | VOOOASOPCDEXPM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|