C29H30N2O2 — CID 59881545
7-(2,4-dimethylphenyl)-7-(2-methyl-1-pentylindol-3-yl)furo[3,4-b]pyridin-5-one (PubChem CID 59881545) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 7-(2,4-dimethylphenyl)-7-(2-methyl-1-pentylindol-3-yl)furo[3,4-b]pyridin-5-one.
| Compound Name | 7-(2,4-dimethylphenyl)-7-(2-methyl-1-pentylindol-3-yl)furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 59881545 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 7-(2,4-dimethylphenyl)-7-(2-methyl-1-pentylindol-3-yl)furo[3,4-b]pyridin-5-one |
| SMILES | CCCCCn1c(C)c(C2(c3ccc(C)cc3C)OC(=O)c3cccnc32)c2ccccc21 |
| InChI | InChI=1S/C29H30N2O2/c1-5-6-9-17-31-21(4)26(22-11-7-8-13-25(22)31)29(24-15-14-19(2)18-20(24)3)27-23(28(32)33-29)12-10-16-30-27/h7-8,10-16,18H,5-6,9,17H2,1-4H3 |
| InChIKey | LRONHAATCCXKHM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|