C23H21NO2 — CID 59881547
7,7-bis(2,4-dimethylphenyl)furo[3,4-b]pyridin-5-one (PubChem CID 59881547) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 7,7-bis(2,4-dimethylphenyl)furo[3,4-b]pyridin-5-one.
| Compound Name | 7,7-bis(2,4-dimethylphenyl)furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 59881547 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 7,7-bis(2,4-dimethylphenyl)furo[3,4-b]pyridin-5-one |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3C)OC(=O)c3cccnc32)c(C)c1 |
| InChI | InChI=1S/C23H21NO2/c1-14-7-9-19(16(3)12-14)23(20-10-8-15(2)13-17(20)4)21-18(22(25)26-23)6-5-11-24-21/h5-13H,1-4H3 |
| InChIKey | VPBNNXZZFOVTTG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |