C39H55N3O2 — CID 139611997
7,7-bis[4-(dibutylamino)-2-methylphenyl]-3-ethylfuro[3,4-b]pyridin-5-one (PubChem CID 139611997) has the molecular formula C39H55N3O2 and a molecular weight of 597.89 g/mol. Its IUPAC name is 7,7-bis[4-(dibutylamino)-2-methylphenyl]-3-ethylfuro[3,4-b]pyridin-5-one.
| Compound Name | 7,7-bis[4-(dibutylamino)-2-methylphenyl]-3-ethylfuro[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139611997 |
| Molecular Formula | C39H55N3O2 |
| Molecular Weight | 597.89 g/mol |
| Exact Mass | 597.43 |
| IUPAC Name | 7,7-bis[4-(dibutylamino)-2-methylphenyl]-3-ethylfuro[3,4-b]pyridin-5-one |
| SMILES | CCCCN(CCCC)c1ccc(C2(c3ccc(N(CCCC)CCCC)cc3C)OC(=O)c3cc(CC)cnc32)c(C)c1 |
| InChI | InChI=1S/C39H55N3O2/c1-8-13-21-41(22-14-9-2)32-17-19-35(29(6)25-32)39(37-34(38(43)44-39)27-31(12-5)28-40-37)36-20-18-33(26-30(36)7)42(23-15-10-3)24-16-11-4/h17-20,25-28H,8-16,21-24H2,1-7H3 |
| InChIKey | PPTHACRQLOMMQD-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.89 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|