C31H39N3O4 — CID 139612004
7,7-bis[4-(diethylamino)-2-methoxyphenyl]-3-ethylfuro[3,4-b]pyridin-5-one (PubChem CID 139612004) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is 7,7-bis[4-(diethylamino)-2-methoxyphenyl]-3-ethylfuro[3,4-b]pyridin-5-one.
| Compound Name | 7,7-bis[4-(diethylamino)-2-methoxyphenyl]-3-ethylfuro[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139612004 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 7,7-bis[4-(diethylamino)-2-methoxyphenyl]-3-ethylfuro[3,4-b]pyridin-5-one |
| SMILES | CCc1cnc2c(c1)C(=O)OC2(c1ccc(N(CC)CC)cc1OC)c1ccc(N(CC)CC)cc1OC |
| InChI | InChI=1S/C31H39N3O4/c1-8-21-17-24-29(32-20-21)31(38-30(24)35,25-15-13-22(18-27(25)36-6)33(9-2)10-3)26-16-14-23(19-28(26)37-7)34(11-4)12-5/h13-20H,8-12H2,1-7H3 |
| InChIKey | WEYQIFDOJNTMMV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|