C32H42N4O2 — CID 139663973
5,5-bis[4-(diethylamino)-2-propan-2-ylphenyl]furo[3,4-b]pyrazin-7-one (PubChem CID 139663973) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is 5,5-bis[4-(diethylamino)-2-propan-2-ylphenyl]furo[3,4-b]pyrazin-7-one.
| Compound Name | 5,5-bis[4-(diethylamino)-2-propan-2-ylphenyl]furo[3,4-b]pyrazin-7-one |
|---|---|
| PubChem CID | 139663973 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 5,5-bis[4-(diethylamino)-2-propan-2-ylphenyl]furo[3,4-b]pyrazin-7-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3C(C)C)OC(=O)c3nccnc32)c(C(C)C)c1 |
| InChI | InChI=1S/C32H42N4O2/c1-9-35(10-2)23-13-15-27(25(19-23)21(5)6)32(30-29(31(37)38-32)33-17-18-34-30)28-16-14-24(36(11-3)12-4)20-26(28)22(7)8/h13-22H,9-12H2,1-8H3 |
| InChIKey | DXAKUUIVYQSKBQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|