C27H30N4O4 — CID 139642782
7-[4-(diethylamino)-2-nitrophenyl]-7-[4-(diethylamino)phenyl]furo[3,4-b]pyridin-5-one (PubChem CID 139642782) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 7-[4-(diethylamino)-2-nitrophenyl]-7-[4-(diethylamino)phenyl]furo[3,4-b]pyridin-5-one.
| Compound Name | 7-[4-(diethylamino)-2-nitrophenyl]-7-[4-(diethylamino)phenyl]furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139642782 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 7-[4-(diethylamino)-2-nitrophenyl]-7-[4-(diethylamino)phenyl]furo[3,4-b]pyridin-5-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3[N+](=O)[O-])OC(=O)c3cccnc32)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-5-29(6-2)20-13-11-19(12-14-20)27(25-22(26(32)35-27)10-9-17-28-25)23-16-15-21(30(7-3)8-4)18-24(23)31(33)34/h9-18H,5-8H2,1-4H3 |
| InChIKey | QYBAEBXLHHYGCO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|