C31H37N3O3 — CID 139802330
7-[4-(diethylamino)-2-methylphenyl]-7-[4-[ethyl(oxolan-2-ylmethyl)amino]phenyl]furo[3,4-b]pyridin-5-one (PubChem CID 139802330) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 7-[4-(diethylamino)-2-methylphenyl]-7-[4-[ethyl(oxolan-2-ylmethyl)amino]phenyl]furo[3,4-b]pyridin-5-one.
| Compound Name | 7-[4-(diethylamino)-2-methylphenyl]-7-[4-[ethyl(oxolan-2-ylmethyl)amino]phenyl]furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139802330 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 7-[4-(diethylamino)-2-methylphenyl]-7-[4-[ethyl(oxolan-2-ylmethyl)amino]phenyl]furo[3,4-b]pyridin-5-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC4CCCO4)cc3)OC(=O)c3cccnc32)c(C)c1 |
| InChI | InChI=1S/C31H37N3O3/c1-5-33(6-2)25-16-17-28(22(4)20-25)31(29-27(30(35)37-31)11-8-18-32-29)23-12-14-24(15-13-23)34(7-3)21-26-10-9-19-36-26/h8,11-18,20,26H,5-7,9-10,19,21H2,1-4H3 |
| InChIKey | NWDSDJMUPTWQHF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|