C26H29N3O2 — CID 139642847
3-[4-(diethylamino)phenyl]-3-[4-(dimethylamino)-2-methylphenyl]furo[3,4-c]pyridin-1-one (PubChem CID 139642847) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[4-(diethylamino)phenyl]-3-[4-(dimethylamino)-2-methylphenyl]furo[3,4-c]pyridin-1-one.
| Compound Name | 3-[4-(diethylamino)phenyl]-3-[4-(dimethylamino)-2-methylphenyl]furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 139642847 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[4-(diethylamino)phenyl]-3-[4-(dimethylamino)-2-methylphenyl]furo[3,4-c]pyridin-1-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(C)C)cc3C)OC(=O)c3ccncc32)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-6-29(7-2)20-10-8-19(9-11-20)26(23-13-12-21(28(4)5)16-18(23)3)24-17-27-15-14-22(24)25(30)31-26/h8-17H,6-7H2,1-5H3 |
| InChIKey | CXYIKANZJFQXOC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|