C25H27N3O2 — CID 139642820
1-[4-(diethylamino)phenyl]-1-[4-(dimethylamino)phenyl]furo[3,4-c]pyridin-3-one (PubChem CID 139642820) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-1-[4-(dimethylamino)phenyl]furo[3,4-c]pyridin-3-one.
| Compound Name | 1-[4-(diethylamino)phenyl]-1-[4-(dimethylamino)phenyl]furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 139642820 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-1-[4-(dimethylamino)phenyl]furo[3,4-c]pyridin-3-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(C)C)cc3)OC(=O)c3cnccc32)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-5-28(6-2)21-13-9-19(10-14-21)25(18-7-11-20(12-8-18)27(3)4)23-15-16-26-17-22(23)24(29)30-25/h7-17H,5-6H2,1-4H3 |
| InChIKey | PLNOPRRNIHLMAU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|