C36H48N2O2 — CID 22292500
3,3-bis[4-(dibutylamino)phenyl]-2-benzofuran-1-one (PubChem CID 22292500) has the molecular formula C36H48N2O2 and a molecular weight of 540.79 g/mol. Its IUPAC name is 3,3-bis[4-(dibutylamino)phenyl]-2-benzofuran-1-one.
| Compound Name | 3,3-bis[4-(dibutylamino)phenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 22292500 |
| Molecular Formula | C36H48N2O2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 3,3-bis[4-(dibutylamino)phenyl]-2-benzofuran-1-one |
| SMILES | CCCCN(CCCC)c1ccc(C2(c3ccc(N(CCCC)CCCC)cc3)OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C36H48N2O2/c1-5-9-25-37(26-10-6-2)31-21-17-29(18-22-31)36(34-16-14-13-15-33(34)35(39)40-36)30-19-23-32(24-20-30)38(27-11-7-3)28-12-8-4/h13-24H,5-12,25-28H2,1-4H3 |
| InChIKey | DJRJYWNDMBCUSJ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|