C29H30N2O2 — CID 174979583
3-[4-(diethylamino)phenyl]-3-(2-propyl-1H-indol-3-yl)-2-benzofuran-1-one (PubChem CID 174979583) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[4-(diethylamino)phenyl]-3-(2-propyl-1H-indol-3-yl)-2-benzofuran-1-one.
| Compound Name | 3-[4-(diethylamino)phenyl]-3-(2-propyl-1H-indol-3-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 174979583 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[4-(diethylamino)phenyl]-3-(2-propyl-1H-indol-3-yl)-2-benzofuran-1-one |
| SMILES | CCCc1[nH]c2ccccc2c1C1(c2ccc(N(CC)CC)cc2)OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H30N2O2/c1-4-11-26-27(23-13-8-10-15-25(23)30-26)29(24-14-9-7-12-22(24)28(32)33-29)20-16-18-21(19-17-20)31(5-2)6-3/h7-10,12-19,30H,4-6,11H2,1-3H3 |
| InChIKey | POHKBYOSOLQZPH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |