C38H40N2O2 — CID 139704931
3-[4-(dibutylamino)phenyl]-3-(1-ethyl-2-phenylindol-3-yl)-2-benzofuran-1-one (PubChem CID 139704931) has the molecular formula C38H40N2O2 and a molecular weight of 556.75 g/mol. Its IUPAC name is 3-[4-(dibutylamino)phenyl]-3-(1-ethyl-2-phenylindol-3-yl)-2-benzofuran-1-one.
| Compound Name | 3-[4-(dibutylamino)phenyl]-3-(1-ethyl-2-phenylindol-3-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139704931 |
| Molecular Formula | C38H40N2O2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 3-[4-(dibutylamino)phenyl]-3-(1-ethyl-2-phenylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CCCCN(CCCC)c1ccc(C2(c3c(-c4ccccc4)n(CC)c4ccccc34)OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C38H40N2O2/c1-4-7-26-39(27-8-5-2)30-24-22-29(23-25-30)38(33-20-14-12-18-31(33)37(41)42-38)35-32-19-13-15-21-34(32)40(6-3)36(35)28-16-10-9-11-17-28/h9-25H,4-8,26-27H2,1-3H3 |
| InChIKey | JGXHLIBUKSVMCV-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |