C33H40N2O4 — CID 122424769
tert-butyl 4-[[1-[4-(dibutylamino)phenyl]-3-oxo-2-benzofuran-1-yl]amino]benzoate (PubChem CID 122424769) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is tert-butyl 4-[[1-[4-(dibutylamino)phenyl]-3-oxo-2-benzofuran-1-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[1-[4-(dibutylamino)phenyl]-3-oxo-2-benzofuran-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 122424769 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tert-butyl 4-[[1-[4-(dibutylamino)phenyl]-3-oxo-2-benzofuran-1-yl]amino]benzoate |
| SMILES | CCCCN(CCCC)c1ccc(C2(Nc3ccc(C(=O)OC(C)(C)C)cc3)OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H40N2O4/c1-6-8-22-35(23-9-7-2)27-20-16-25(17-21-27)33(29-13-11-10-12-28(29)31(37)39-33)34-26-18-14-24(15-19-26)30(36)38-32(3,4)5/h10-21,34H,6-9,22-23H2,1-5H3 |
| InChIKey | ZLTDWRIQKPNFSH-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |