C36H38N2O4 — CID 102409140
tert-butyl 4-[17-(dibutylamino)-3,20-dioxa-5-azapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),4,7,9,11,14(19),15,17-nonaen-4-yl]benzoate (PubChem CID 102409140) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is tert-butyl 4-[17-(dibutylamino)-3,20-dioxa-5-azapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),4,7,9,11,14(19),15,17-nonaen-4-yl]benzoate.
| Compound Name | tert-butyl 4-[17-(dibutylamino)-3,20-dioxa-5-azapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),4,7,9,11,14(19),15,17-nonaen-4-yl]benzoate |
|---|---|
| PubChem CID | 102409140 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl 4-[17-(dibutylamino)-3,20-dioxa-5-azapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),4,7,9,11,14(19),15,17-nonaen-4-yl]benzoate |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)oc1c3oc(-c4ccc(C(=O)OC(C)(C)C)cc4)nc3c3ccccc3c21 |
| InChI | InChI=1S/C36H38N2O4/c1-6-8-20-38(21-9-7-2)25-18-19-28-29(22-25)40-32-30(28)26-12-10-11-13-27(26)31-33(32)41-34(37-31)23-14-16-24(17-15-23)35(39)42-36(3,4)5/h10-19,22H,6-9,20-21H2,1-5H3 |
| InChIKey | RKNVKMHWUHVBQY-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |