C24H27NO3 — CID 10883366
3-(dibutylamino)naphtho[3,2-b][1]benzofuran-6,11-diol (PubChem CID 10883366) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-(dibutylamino)naphtho[3,2-b][1]benzofuran-6,11-diol.
| Compound Name | 3-(dibutylamino)naphtho[3,2-b][1]benzofuran-6,11-diol |
|---|---|
| PubChem CID | 10883366 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-(dibutylamino)naphtho[3,2-b][1]benzofuran-6,11-diol |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)oc1c(O)c3ccccc3c(O)c12 |
| InChI | InChI=1S/C24H27NO3/c1-3-5-13-25(14-6-4-2)16-11-12-19-20(15-16)28-24-21(19)22(26)17-9-7-8-10-18(17)23(24)27/h7-12,15,26-27H,3-6,13-14H2,1-2H3 |
| InChIKey | KMFZDUJTDXWTPV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|