C34H47N2O3+ — CID 123138139
[10-(dioctylamino)-6-oxochromeno[4,3-b]chromen-3-ylidene]-dimethylazanium (PubChem CID 123138139) has the molecular formula C34H47N2O3+ and a molecular weight of 531.76 g/mol. Its IUPAC name is [10-(dioctylamino)-6-oxochromeno[4,3-b]chromen-3-ylidene]-dimethylazanium.
| Compound Name | [10-(dioctylamino)-6-oxochromeno[4,3-b]chromen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123138139 |
| Molecular Formula | C34H47N2O3+ |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | [10-(dioctylamino)-6-oxochromeno[4,3-b]chromen-3-ylidene]-dimethylazanium |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc2cc3c(=O)oc4cc(=[N+](C)C)ccc4c3oc2c1 |
| InChI | InChI=1S/C34H47N2O3/c1-5-7-9-11-13-15-21-36(22-16-14-12-10-8-6-2)28-18-17-26-23-30-33(38-31(26)25-28)29-20-19-27(35(3)4)24-32(29)39-34(30)37/h17-20,23-25H,5-16,21-22H2,1-4H3/q+1 |
| InChIKey | YJRFJQWIUMRKOK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 49.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|