C26H26N2O4 — CID 142217669
6,16-bis(diethylamino)-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-1(12),2(11),3(8),4,6,13(18),14,16-octaene-10,20-dione (PubChem CID 142217669) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 6,16-bis(diethylamino)-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-1(12),2(11),3(8),4,6,13(18),14,16-octaene-10,20-dione.
| Compound Name | 6,16-bis(diethylamino)-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-1(12),2(11),3(8),4,6,13(18),14,16-octaene-10,20-dione |
|---|---|
| PubChem CID | 142217669 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6,16-bis(diethylamino)-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-1(12),2(11),3(8),4,6,13(18),14,16-octaene-10,20-dione |
| SMILES | CCN(CC)c1ccc2c3c(c(=O)oc2c1)-c1c-3c(=O)oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C26H26N2O4/c1-5-27(6-2)15-9-11-17-19(13-15)31-25(29)23-21(17)24-22(23)18-12-10-16(28(7-3)8-4)14-20(18)32-26(24)30/h9-14H,5-8H2,1-4H3 |
| InChIKey | ZEWKJIDPQWPZRM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|