C14H17NO6S-2 — CID 23622381
7-(diethylamino)-4-methylchromen-2-one sulfate (PubChem CID 23622381) has the molecular formula C14H17NO6S-2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 7-(diethylamino)-4-methylchromen-2-one sulfate.
| Compound Name | 7-(diethylamino)-4-methylchromen-2-one sulfate |
|---|---|
| PubChem CID | 23622381 |
| Molecular Formula | C14H17NO6S-2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 7-(diethylamino)-4-methylchromen-2-one sulfate |
| SMILES | CCN(CC)c1ccc2c(C)cc(=O)oc2c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C14H17NO2.H2O4S/c1-4-15(5-2)11-6-7-12-10(3)8-14(16)17-13(12)9-11;1-5(2,3)4/h6-9H,4-5H2,1-3H3;(H2,1,2,3,4)/p-2 |
| InChIKey | GDWRXKBWBVIFLI-UHFFFAOYSA-L |
| XLogP | 1.61 |
| TPSA | 113.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|