C17H21NO5 — CID 154718163
7-(diethylamino)-4-(5-hydroxy-1,3-dioxan-2-yl)chromen-2-one (PubChem CID 154718163) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 7-(diethylamino)-4-(5-hydroxy-1,3-dioxan-2-yl)chromen-2-one.
| Compound Name | 7-(diethylamino)-4-(5-hydroxy-1,3-dioxan-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 154718163 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 7-(diethylamino)-4-(5-hydroxy-1,3-dioxan-2-yl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2c(C3OCC(O)CO3)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H21NO5/c1-3-18(4-2)11-5-6-13-14(8-16(20)23-15(13)7-11)17-21-9-12(19)10-22-17/h5-8,12,17,19H,3-4,9-10H2,1-2H3 |
| InChIKey | UCSDWKAXVMIHIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|