C15H19NO2 — CID 11736705
7-(diethylamino)-4,6-dimethylchromen-2-one (PubChem CID 11736705) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 7-(diethylamino)-4,6-dimethylchromen-2-one.
| Compound Name | 7-(diethylamino)-4,6-dimethylchromen-2-one |
|---|---|
| PubChem CID | 11736705 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 7-(diethylamino)-4,6-dimethylchromen-2-one |
| SMILES | CCN(CC)c1cc2oc(=O)cc(C)c2cc1C |
| InChI | InChI=1S/C15H19NO2/c1-5-16(6-2)13-9-14-12(7-11(13)4)10(3)8-15(17)18-14/h7-9H,5-6H2,1-4H3 |
| InChIKey | LCSNPEIXPRTDCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|