C31H39NO3 — CID 142932648
9-[hexyl(nonyl)amino]naphtho[2,1-b][1]benzofuran-5,6-dione (PubChem CID 142932648) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is 9-[hexyl(nonyl)amino]naphtho[2,1-b][1]benzofuran-5,6-dione.
| Compound Name | 9-[hexyl(nonyl)amino]naphtho[2,1-b][1]benzofuran-5,6-dione |
|---|---|
| PubChem CID | 142932648 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 9-[hexyl(nonyl)amino]naphtho[2,1-b][1]benzofuran-5,6-dione |
| SMILES | CCCCCCCCCN(CCCCCC)c1ccc2c3c(oc2c1)C(=O)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C31H39NO3/c1-3-5-7-9-10-11-15-21-32(20-14-8-6-4-2)23-18-19-26-27(22-23)35-31-28(26)24-16-12-13-17-25(24)29(33)30(31)34/h12-13,16-19,22H,3-11,14-15,20-21H2,1-2H3 |
| InChIKey | KMVGZSOFEDLCDQ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|