C31H38N2O6S — CID 140926838
2-[3-[butyl(2-hydroxyethyl)amino]-6-[butyl(2-hydroxyethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate (PubChem CID 140926838) has the molecular formula C31H38N2O6S and a molecular weight of 566.72 g/mol. Its IUPAC name is 2-[3-[butyl(2-hydroxyethyl)amino]-6-[butyl(2-hydroxyethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[3-[butyl(2-hydroxyethyl)amino]-6-[butyl(2-hydroxyethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 140926838 |
| Molecular Formula | C31H38N2O6S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2-[3-[butyl(2-hydroxyethyl)amino]-6-[butyl(2-hydroxyethyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
| SMILES | CCCCN(CCO)c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[N+](\CCO)CCCC)cc-3oc2c1 |
| InChI | InChI=1S/C31H38N2O6S/c1-3-5-15-32(17-19-34)23-11-13-25-28(21-23)39-29-22-24(33(18-20-35)16-6-4-2)12-14-26(29)31(25)27-9-7-8-10-30(27)40(36,37)38/h7-14,21-22,34-35H,3-6,15-20H2,1-2H3 |
| InChIKey | RYUGLCLGDLKIME-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|