C41H42N2O4S3 — CID 154627238
2-[3-[ethyl(3-phenylsulfanylpropyl)amino]-6-[ethyl(3-phenylsulfanylpropyl)azaniumylidene]xanthen-9-yl]benzenesulfonate (PubChem CID 154627238) has the molecular formula C41H42N2O4S3 and a molecular weight of 723.00 g/mol. Its IUPAC name is 2-[3-[ethyl(3-phenylsulfanylpropyl)amino]-6-[ethyl(3-phenylsulfanylpropyl)azaniumylidene]xanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[3-[ethyl(3-phenylsulfanylpropyl)amino]-6-[ethyl(3-phenylsulfanylpropyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 154627238 |
| Molecular Formula | C41H42N2O4S3 |
| Molecular Weight | 723.00 g/mol |
| Exact Mass | 722.23 |
| IUPAC Name | 2-[3-[ethyl(3-phenylsulfanylpropyl)amino]-6-[ethyl(3-phenylsulfanylpropyl)azaniumylidene]xanthen-9-yl]benzenesulfonate |
| SMILES | CCN(CCCSc1ccccc1)c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[N+](\CC)CCCSc4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C41H42N2O4S3/c1-3-42(25-13-27-48-33-15-7-5-8-16-33)31-21-23-35-38(29-31)47-39-30-32(43(4-2)26-14-28-49-34-17-9-6-10-18-34)22-24-36(39)41(35)37-19-11-12-20-40(37)50(44,45)46/h5-12,15-24,29-30H,3-4,13-14,25-28H2,1-2H3 |
| InChIKey | FXKGTYJGHKFFQR-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.00 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|