C41H41N4O8S+ — CID 130374732
ethyl-[6-[ethyl-[2-(phenylcarbamoyloxy)ethyl]amino]-9-(2-sulfophenyl)xanthen-3-ylidene]-[2-(phenylcarbamoyloxy)ethyl]azanium (PubChem CID 130374732) has the molecular formula C41H41N4O8S+ and a molecular weight of 749.87 g/mol. Its IUPAC name is ethyl-[6-[ethyl-[2-(phenylcarbamoyloxy)ethyl]amino]-9-(2-sulfophenyl)xanthen-3-ylidene]-[2-(phenylcarbamoyloxy)ethyl]azanium.
| Compound Name | ethyl-[6-[ethyl-[2-(phenylcarbamoyloxy)ethyl]amino]-9-(2-sulfophenyl)xanthen-3-ylidene]-[2-(phenylcarbamoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 130374732 |
| Molecular Formula | C41H41N4O8S+ |
| Molecular Weight | 749.87 g/mol |
| Exact Mass | 749.26 |
| IUPAC Name | ethyl-[6-[ethyl-[2-(phenylcarbamoyloxy)ethyl]amino]-9-(2-sulfophenyl)xanthen-3-ylidene]-[2-(phenylcarbamoyloxy)ethyl]azanium |
| SMILES | CCN(CCOC(=O)Nc1ccccc1)c1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc/c(=[N+](/CC)CCOC(=O)Nc4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C41H40N4O8S/c1-3-44(23-25-51-40(46)42-29-13-7-5-8-14-29)31-19-21-33-36(27-31)53-37-28-32(45(4-2)24-26-52-41(47)43-30-15-9-6-10-16-30)20-22-34(37)39(33)35-17-11-12-18-38(35)54(48,49)50/h5-22,27-28H,3-4,23-26H2,1-2H3,(H2-,42,43,46,47,48,49,50)/p+1 |
| InChIKey | MLRKBBPBEAEWOL-UHFFFAOYSA-O |
| XLogP | 7.57 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.87 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|