C31H38N3O8S2+ — CID 132562068
[6-(diethylamino)-9-[4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 132562068) has the molecular formula C31H38N3O8S2+ and a molecular weight of 644.79 g/mol. Its IUPAC name is [6-(diethylamino)-9-[4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 132562068 |
| Molecular Formula | C31H38N3O8S2+ |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | [6-(diethylamino)-9-[4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NC(C)C(=O)OC)cc3S(=O)(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C31H37N3O8S2/c1-7-33(8-2)21-11-14-24-27(17-21)42-28-18-22(34(9-3)10-4)12-15-25(28)30(24)26-16-13-23(19-29(26)44(38,39)40)43(36,37)32-20(5)31(35)41-6/h11-20,32H,7-10H2,1-6H3/p+1 |
| InChIKey | XYNOQGXSHQVFSF-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|