C33H43N7O7S2 — CID 58992332
5-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate (PubChem CID 58992332) has the molecular formula C33H43N7O7S2 and a molecular weight of 713.88 g/mol. Its IUPAC name is 5-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate.
| Compound Name | 5-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 58992332 |
| Molecular Formula | C33H43N7O7S2 |
| Molecular Weight | 713.88 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | 5-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]sulfamoyl]-2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NC(CCCN=C(N)N)C(N)=O)cc3S(=O)(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H43N7O7S2/c1-5-39(6-2)21-11-14-24-28(18-21)47-29-19-22(40(7-3)8-4)12-15-25(29)31(24)26-16-13-23(20-30(26)49(44,45)46)48(42,43)38-27(32(34)41)10-9-17-37-33(35)36/h11-16,18-20,27,38H,5-10,17H2,1-4H3,(H6-,34,35,36,37,41,44,45,46) |
| InChIKey | JMKDJKWGZKDRHZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 230.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.88 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|