C28H32N3O2+ — CID 118912539
[9-(2-carbamoylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 118912539) has the molecular formula C28H32N3O2+ and a molecular weight of 442.58 g/mol. Its IUPAC name is [9-(2-carbamoylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-(2-carbamoylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 118912539 |
| Molecular Formula | C28H32N3O2+ |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [9-(2-carbamoylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(N)=O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C28H31N3O2/c1-5-30(6-2)19-13-15-23-25(17-19)33-26-18-20(31(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(29)32/h9-18H,5-8H2,1-4H3,(H-,29,32)/p+1 |
| InChIKey | SJFNGAAFGFOLLP-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|