C30H37N4O2+ — CID 15487029
[9-[2-(2-aminoethylcarbamoyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 15487029) has the molecular formula C30H37N4O2+ and a molecular weight of 485.65 g/mol. Its IUPAC name is [9-[2-(2-aminoethylcarbamoyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-(2-aminoethylcarbamoyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 15487029 |
| Molecular Formula | C30H37N4O2+ |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | [9-[2-(2-aminoethylcarbamoyl)phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)NCCN)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C30H36N4O2/c1-5-33(6-2)21-13-15-25-27(19-21)36-28-20-22(34(7-3)8-4)14-16-26(28)29(25)23-11-9-10-12-24(23)30(35)32-18-17-31/h9-16,19-20H,5-8,17-18,31H2,1-4H3/p+1 |
| InChIKey | GIZNJVLJNBRKOD-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|