C33H41N3O3 — CID 25068810
4-[[2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzoyl]-methylamino]butan-1-olate (PubChem CID 25068810) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-[[2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzoyl]-methylamino]butan-1-olate.
| Compound Name | 4-[[2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzoyl]-methylamino]butan-1-olate |
|---|---|
| PubChem CID | 25068810 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 4-[[2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzoyl]-methylamino]butan-1-olate |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N(C)CCCC[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H41N3O3/c1-6-35(7-2)24-16-18-28-30(22-24)39-31-23-25(36(8-3)9-4)17-19-29(31)32(28)26-14-10-11-15-27(26)33(38)34(5)20-12-13-21-37/h10-11,14-19,22-23H,6-9,12-13,20-21H2,1-5H3 |
| InChIKey | PUADKKLUVGHDIY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|