C32H37BrN2O5 — CID 159455815
[6-(diethylamino)-9-[2-(2-ethoxy-2-oxoethoxy)carbonylphenyl]xanthen-3-ylidene]-diethylazanium bromide (PubChem CID 159455815) has the molecular formula C32H37BrN2O5 and a molecular weight of 609.56 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-(2-ethoxy-2-oxoethoxy)carbonylphenyl]xanthen-3-ylidene]-diethylazanium bromide.
| Compound Name | [6-(diethylamino)-9-[2-(2-ethoxy-2-oxoethoxy)carbonylphenyl]xanthen-3-ylidene]-diethylazanium bromide |
|---|---|
| PubChem CID | 159455815 |
| Molecular Formula | C32H37BrN2O5 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [6-(diethylamino)-9-[2-(2-ethoxy-2-oxoethoxy)carbonylphenyl]xanthen-3-ylidene]-diethylazanium bromide |
| SMILES | CCOC(=O)COC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12.[Br-] |
| InChI | InChI=1S/C32H37N2O5.BrH/c1-6-33(7-2)22-15-17-26-28(19-22)39-29-20-23(34(8-3)9-4)16-18-27(29)31(26)24-13-11-12-14-25(24)32(36)38-21-30(35)37-10-5;/h11-20H,6-10,21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | QMHHJIHKHGNDDT-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 71.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|