C33H41ClN4O2 — CID 140863563
[6-(diethylamino)-9-[2-(4-methylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium chloride (PubChem CID 140863563) has the molecular formula C33H41ClN4O2 and a molecular weight of 561.17 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-(4-methylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium chloride.
| Compound Name | [6-(diethylamino)-9-[2-(4-methylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium chloride |
|---|---|
| PubChem CID | 140863563 |
| Molecular Formula | C33H41ClN4O2 |
| Molecular Weight | 561.17 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [6-(diethylamino)-9-[2-(4-methylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium chloride |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N3CCN(C)CC3)c3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C33H41N4O2.ClH/c1-6-35(7-2)24-14-16-28-30(22-24)39-31-23-25(36(8-3)9-4)15-17-29(31)32(28)26-12-10-11-13-27(26)33(38)37-20-18-34(5)19-21-37;/h10-17,22-23H,6-9,18-21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | ZOIRMCSSXMPMNK-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|