C38H46N7O4+ — CID 164680249
[6-(diethylamino)-9-[2-[4-[2-[(1-methyltriazol-4-yl)methoxy]acetyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 164680249) has the molecular formula C38H46N7O4+ and a molecular weight of 664.83 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[4-[2-[(1-methyltriazol-4-yl)methoxy]acetyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[4-[2-[(1-methyltriazol-4-yl)methoxy]acetyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 164680249 |
| Molecular Formula | C38H46N7O4+ |
| Molecular Weight | 664.83 g/mol |
| Exact Mass | 664.36 |
| IUPAC Name | [6-(diethylamino)-9-[2-[4-[2-[(1-methyltriazol-4-yl)methoxy]acetyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N3CCN(C(=O)COCc4cn(C)nn4)CC3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C38H46N7O4/c1-6-42(7-2)28-14-16-32-34(22-28)49-35-23-29(43(8-3)9-4)15-17-33(35)37(32)30-12-10-11-13-31(30)38(47)45-20-18-44(19-21-45)36(46)26-48-25-27-24-41(5)40-39-27/h10-17,22-24H,6-9,18-21,25-26H2,1-5H3/q+1 |
| InChIKey | WZMIUEDZRCNNNZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|