C26H27N2O3+ — CID 58120347
[9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 58120347) has the molecular formula C26H27N2O3+ and a molecular weight of 415.51 g/mol. Its IUPAC name is [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 58120347 |
| Molecular Formula | C26H27N2O3+ |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C26H26N2O3/c1-5-28(6-2)18-12-14-22-24(16-18)31-23-15-17(27(3)4)11-13-21(23)25(22)19-9-7-8-10-20(19)26(29)30/h7-16H,5-6H2,1-4H3/p+1 |
| InChIKey | XPMSLTDSISMLHF-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|