C31H38N3O3+ — CID 101251572
[6-(diethylamino)-9-[2-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 101251572) has the molecular formula C31H38N3O3+ and a molecular weight of 500.66 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 101251572 |
| Molecular Formula | C31H38N3O3+ |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | [6-(diethylamino)-9-[2-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N[C@H](C)CO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C31H37N3O3/c1-6-33(7-2)22-14-16-26-28(18-22)37-29-19-23(34(8-3)9-4)15-17-27(29)30(26)24-12-10-11-13-25(24)31(36)32-21(5)20-35/h10-19,21,35H,6-9,20H2,1-5H3/p+1/t21-/m1/s1 |
| InChIKey | GNRPYXYCECSYRE-OAQYLSRUSA-O |
| XLogP | 4.97 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|