C32H36N3O2+ — CID 88566685
[6-(diethylamino)-9-[2-[methyl(prop-2-ynyl)carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 88566685) has the molecular formula C32H36N3O2+ and a molecular weight of 494.66 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[methyl(prop-2-ynyl)carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[methyl(prop-2-ynyl)carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 88566685 |
| Molecular Formula | C32H36N3O2+ |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | [6-(diethylamino)-9-[2-[methyl(prop-2-ynyl)carbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | C#CCN(C)C(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C32H36N3O2/c1-7-20-33(6)32(36)26-15-13-12-14-25(26)31-27-18-16-23(34(8-2)9-3)21-29(27)37-30-22-24(17-19-28(30)31)35(10-4)11-5/h1,12-19,21-22H,8-11,20H2,2-6H3/q+1 |
| InChIKey | NEURWFHRXFZDGU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 39.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|