C36H46N3O4+ — CID 118638187
[6-(diethylamino)-9-[2-[3-(2-methylbutanoylamino)propoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 118638187) has the molecular formula C36H46N3O4+ and a molecular weight of 584.78 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[3-(2-methylbutanoylamino)propoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[3-(2-methylbutanoylamino)propoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 118638187 |
| Molecular Formula | C36H46N3O4+ |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | [6-(diethylamino)-9-[2-[3-(2-methylbutanoylamino)propoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCC(C)C(=O)NCCCOC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C36H45N3O4/c1-7-25(6)35(40)37-21-14-22-42-36(41)29-16-13-12-15-28(29)34-30-19-17-26(38(8-2)9-3)23-32(30)43-33-24-27(18-20-31(33)34)39(10-4)11-5/h12-13,15-20,23-25H,7-11,14,21-22H2,1-6H3/p+1 |
| InChIKey | AOKJVQXDSRWZHH-UHFFFAOYSA-O |
| XLogP | 6.57 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|