C39H45N4O4+ — CID 121246718
[9-[2-[3-[(4-aminobenzoyl)amino]propoxycarbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-ethyl-propylazanium (PubChem CID 121246718) has the molecular formula C39H45N4O4+ and a molecular weight of 633.81 g/mol. Its IUPAC name is [9-[2-[3-[(4-aminobenzoyl)amino]propoxycarbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-ethyl-propylazanium.
| Compound Name | [9-[2-[3-[(4-aminobenzoyl)amino]propoxycarbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-ethyl-propylazanium |
|---|---|
| PubChem CID | 121246718 |
| Molecular Formula | C39H45N4O4+ |
| Molecular Weight | 633.81 g/mol |
| Exact Mass | 633.34 |
| IUPAC Name | [9-[2-[3-[(4-aminobenzoyl)amino]propoxycarbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-ethyl-propylazanium |
| SMILES | CCC/[N+](CC)=c1\ccc2c(-c3ccccc3C(=O)OCCCNC(=O)c3ccc(N)cc3)c3ccc(N(CC)CC)cc3oc-2c1 |
| InChI | InChI=1S/C39H44N4O4/c1-5-23-43(8-4)30-19-21-34-36(26-30)47-35-25-29(42(6-2)7-3)18-20-33(35)37(34)31-12-9-10-13-32(31)39(45)46-24-11-22-41-38(44)27-14-16-28(40)17-15-27/h9-10,12-21,25-26H,5-8,11,22-24H2,1-4H3,(H2-,40,41,44)/p+1 |
| InChIKey | UASPNWUEAMMDMW-UHFFFAOYSA-O |
| XLogP | 6.81 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.81 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|