C45H59N2O5+ — CID 122498144
[6-(diethylamino)-9-[2-[9-(3,6-dihydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)nonoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 122498144) has the molecular formula C45H59N2O5+ and a molecular weight of 707.98 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[9-(3,6-dihydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)nonoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[9-(3,6-dihydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)nonoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 122498144 |
| Molecular Formula | C45H59N2O5+ |
| Molecular Weight | 707.98 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | [6-(diethylamino)-9-[2-[9-(3,6-dihydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)nonoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)OCCCCCCCCCC3=CC(O)C(C)=C(C)C3O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C45H59N2O5/c1-7-46(8-2)34-23-25-38-41(29-34)52-42-30-35(47(9-3)10-4)24-26-39(42)43(38)36-21-17-18-22-37(36)45(50)51-27-19-15-13-11-12-14-16-20-33-28-40(48)31(5)32(6)44(33)49/h17-18,21-26,28-30,40,44,48-49H,7-16,19-20,27H2,1-6H3/q+1 |
| InChIKey | CXUFLAQCGNZBPB-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.98 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|