C34H43N2O5+ — CID 118638227
[9-(2-butoxycarbonylphenyl)-6-[ethyl(2-methoxyethyl)amino]xanthen-3-ylidene]-ethyl-(2-methoxyethyl)azanium (PubChem CID 118638227) has the molecular formula C34H43N2O5+ and a molecular weight of 559.73 g/mol. Its IUPAC name is [9-(2-butoxycarbonylphenyl)-6-[ethyl(2-methoxyethyl)amino]xanthen-3-ylidene]-ethyl-(2-methoxyethyl)azanium.
| Compound Name | [9-(2-butoxycarbonylphenyl)-6-[ethyl(2-methoxyethyl)amino]xanthen-3-ylidene]-ethyl-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 118638227 |
| Molecular Formula | C34H43N2O5+ |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | [9-(2-butoxycarbonylphenyl)-6-[ethyl(2-methoxyethyl)amino]xanthen-3-ylidene]-ethyl-(2-methoxyethyl)azanium |
| SMILES | CCCCOC(=O)c1ccccc1-c1c2cc/c(=[N+](\CC)CCOC)cc-2oc2cc(N(CC)CCOC)ccc12 |
| InChI | InChI=1S/C34H43N2O5/c1-6-9-20-40-34(37)28-13-11-10-12-27(28)33-29-16-14-25(35(7-2)18-21-38-4)23-31(29)41-32-24-26(15-17-30(32)33)36(8-3)19-22-39-5/h10-17,23-24H,6-9,18-22H2,1-5H3/q+1 |
| InChIKey | QJTUQGPRZMJLPR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|