C37H45N2O5+ — CID 121288262
[6-(diethylamino)-9-[2-[5-(2-methylprop-2-enoyloxy)pentoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 121288262) has the molecular formula C37H45N2O5+ and a molecular weight of 597.78 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[5-(2-methylprop-2-enoyloxy)pentoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[5-(2-methylprop-2-enoyloxy)pentoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 121288262 |
| Molecular Formula | C37H45N2O5+ |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | [6-(diethylamino)-9-[2-[5-(2-methylprop-2-enoyloxy)pentoxycarbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | C=C(C)C(=O)OCCCCCOC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C37H45N2O5/c1-7-38(8-2)27-18-20-31-33(24-27)44-34-25-28(39(9-3)10-4)19-21-32(34)35(31)29-16-12-13-17-30(29)37(41)43-23-15-11-14-22-42-36(40)26(5)6/h12-13,16-21,24-25H,5,7-11,14-15,22-23H2,1-4,6H3/q+1 |
| InChIKey | HXIVZLNQVVZAHM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 71.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|