C32H37N2O3+ — CID 86267538
[6-(diethylamino)-9-[2-(2-methylprop-2-enoyloxymethyl)phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 86267538) has the molecular formula C32H37N2O3+ and a molecular weight of 497.66 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-(2-methylprop-2-enoyloxymethyl)phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-(2-methylprop-2-enoyloxymethyl)phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 86267538 |
| Molecular Formula | C32H37N2O3+ |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | [6-(diethylamino)-9-[2-(2-methylprop-2-enoyloxymethyl)phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | C=C(C)C(=O)OCc1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C32H37N2O3/c1-7-33(8-2)24-15-17-27-29(19-24)37-30-20-25(34(9-3)10-4)16-18-28(30)31(27)26-14-12-11-13-23(26)21-36-32(35)22(5)6/h11-20H,5,7-10,21H2,1-4,6H3/q+1 |
| InChIKey | VFHRVXPIXBJYKL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 45.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|