C27H31N2O3+ — CID 129107919
[6-(diethylamino)-9-(2-hydroperoxyphenyl)xanthen-3-ylidene]-diethylazanium (PubChem CID 129107919) has the molecular formula C27H31N2O3+ and a molecular weight of 431.56 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2-hydroperoxyphenyl)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-(2-hydroperoxyphenyl)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 129107919 |
| Molecular Formula | C27H31N2O3+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [6-(diethylamino)-9-(2-hydroperoxyphenyl)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3OO)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C27H30N2O3/c1-5-28(6-2)19-13-15-22-25(17-19)31-26-18-20(29(7-3)8-4)14-16-23(26)27(22)21-11-9-10-12-24(21)32-30/h9-18H,5-8H2,1-4H3/p+1 |
| InChIKey | MBNGXZOAIYUNAJ-UHFFFAOYSA-O |
| XLogP | 5.71 |
| TPSA | 48.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|