C28H31N2O3+ — CID 145186892
[6-(diethylamino)-9-(2-formyloxyphenyl)xanthen-3-ylidene]-diethylazanium (PubChem CID 145186892) has the molecular formula C28H31N2O3+ and a molecular weight of 443.57 g/mol. Its IUPAC name is [6-(diethylamino)-9-(2-formyloxyphenyl)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-(2-formyloxyphenyl)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 145186892 |
| Molecular Formula | C28H31N2O3+ |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [6-(diethylamino)-9-(2-formyloxyphenyl)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3OC=O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C28H31N2O3/c1-5-29(6-2)20-13-15-23-26(17-20)33-27-18-21(30(7-3)8-4)14-16-24(27)28(23)22-11-9-10-12-25(22)32-19-31/h9-19H,5-8H2,1-4H3/q+1 |
| InChIKey | ZBIGXXUMCVNSPG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 45.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|