C33H39N3O8S2 — CID 177403555
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[2-(2-methylprop-2-enoyloxy)ethylsulfamoyl]benzenesulfonate (PubChem CID 177403555) has the molecular formula C33H39N3O8S2 and a molecular weight of 669.82 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[2-(2-methylprop-2-enoyloxy)ethylsulfamoyl]benzenesulfonate.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[2-(2-methylprop-2-enoyloxy)ethylsulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 177403555 |
| Molecular Formula | C33H39N3O8S2 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[2-(2-methylprop-2-enoyloxy)ethylsulfamoyl]benzenesulfonate |
| SMILES | C=C(C)C(=O)OCCNS(=O)(=O)c1ccc(-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C33H39N3O8S2/c1-7-35(8-2)23-11-14-26-29(19-23)44-30-20-24(36(9-3)10-4)12-15-27(30)32(26)28-16-13-25(21-31(28)46(40,41)42)45(38,39)34-17-18-43-33(37)22(5)6/h11-16,19-21,34H,5,7-10,17-18H2,1-4,6H3 |
| InChIKey | WWWDRPBMKPNESL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|