C33H39N5O6S2 — CID 58729516
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-(3-imidazol-1-ylpropylsulfamoyl)benzenesulfonate (PubChem CID 58729516) has the molecular formula C33H39N5O6S2 and a molecular weight of 665.84 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-(3-imidazol-1-ylpropylsulfamoyl)benzenesulfonate.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-(3-imidazol-1-ylpropylsulfamoyl)benzenesulfonate |
|---|---|
| PubChem CID | 58729516 |
| Molecular Formula | C33H39N5O6S2 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-(3-imidazol-1-ylpropylsulfamoyl)benzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCCCn4ccnc4)cc3S(=O)(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C33H39N5O6S2/c1-5-37(6-2)24-10-13-27-30(20-24)44-31-21-25(38(7-3)8-4)11-14-28(31)33(27)29-15-12-26(22-32(29)46(41,42)43)45(39,40)35-16-9-18-36-19-17-34-23-36/h10-15,17,19-23,35H,5-9,16,18H2,1-4H3 |
| InChIKey | FSJGWOPBXFYJGL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|