C34H44N3O8S2+ — CID 87583908
[6-(diethylamino)-9-[4-[(6-methoxy-6-oxohexyl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 87583908) has the molecular formula C34H44N3O8S2+ and a molecular weight of 686.87 g/mol. Its IUPAC name is [6-(diethylamino)-9-[4-[(6-methoxy-6-oxohexyl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[4-[(6-methoxy-6-oxohexyl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 87583908 |
| Molecular Formula | C34H44N3O8S2+ |
| Molecular Weight | 686.87 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | [6-(diethylamino)-9-[4-[(6-methoxy-6-oxohexyl)sulfamoyl]-2-sulfophenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCCCCCC(=O)OC)cc3S(=O)(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C34H43N3O8S2/c1-6-36(7-2)24-14-17-27-30(21-24)45-31-22-25(37(8-3)9-4)15-18-28(31)34(27)29-19-16-26(23-32(29)47(41,42)43)46(39,40)35-20-12-10-11-13-33(38)44-5/h14-19,21-23,35H,6-13,20H2,1-5H3/p+1 |
| InChIKey | HJQHFAFTSWXQRO-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|