C37H48N4O9S3 — CID 54591344
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[6-(2-ethenylsulfonylethylamino)-6-oxohexyl]sulfamoyl]benzenesulfonate (PubChem CID 54591344) has the molecular formula C37H48N4O9S3 and a molecular weight of 789.01 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[6-(2-ethenylsulfonylethylamino)-6-oxohexyl]sulfamoyl]benzenesulfonate.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[6-(2-ethenylsulfonylethylamino)-6-oxohexyl]sulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 54591344 |
| Molecular Formula | C37H48N4O9S3 |
| Molecular Weight | 789.01 g/mol |
| Exact Mass | 788.26 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[6-(2-ethenylsulfonylethylamino)-6-oxohexyl]sulfamoyl]benzenesulfonate |
| SMILES | C=CS(=O)(=O)CCNC(=O)CCCCCNS(=O)(=O)c1ccc(-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C37H48N4O9S3/c1-6-40(7-2)27-15-18-30-33(24-27)50-34-25-28(41(8-3)9-4)16-19-31(34)37(30)32-20-17-29(26-35(32)53(47,48)49)52(45,46)39-21-13-11-12-14-36(42)38-22-23-51(43,44)10-5/h10,15-20,24-26,39H,5-9,11-14,21-23H2,1-4H3,(H-,38,42,47,48,49) |
| InChIKey | HLMTUVBEUMXWPS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|